عرض مصدر ثلاثي يود الثايرونين العكسي

{{معلومات كيمياء
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 441431793
| صورة = Reverse triiodothyronine.svg
| حجم صورة = 230px
| بديل صورة = Skeletal formula of reverse triiodothyronine
| صورة1 = Reverse triiodothyronine zwitterion 3D ball.png
| حجم صورة1 = 230px
| بديل صورة1 = Ball-and-stick model of the reverse triiodothyronine molecule as a zwitterion
| الاسم النظامي =  (2''S'')-2-Amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenyl]propanoic acid
| أسماء أخرى = 
|قسم1={{معلومات كيمياء - معرفات
| IUPHAR_ligand = 2636
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 5817-39-0
| PubChem = 22069
| SMILES = C1=CC(=C(C=C1C[C@@H](C(=O)O)N)I)OC2=CC(=C(C(=C2)I)O)I
| MeSHName = Reverse+triiodothyronine
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 559294
| InChI = 1/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22)/t12-/m0/s1
| InChIKey = HZCBWYNLGPIQRK-LBPRGKRZBV
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22)/t12-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = HZCBWYNLGPIQRK-LBPRGKRZSA-N
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 11684
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C07639
  }}
|قسم2={{معلومات كيمياء - خواص
| Formula = C<sub>15</sub>H<sub>12</sub>I<sub>3</sub>NO<sub>4</sub>
| MolarMass = 650.974
| Appearance = 
| Density = 
|   MeltingPt = 
| BoilingPt = 
  }}
|قسم3={{معلومات كيمياء - مخاطر 
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}

'''ثلاثي يود الثايرونين العكسي''' (3,3’,5’-ثلاثي يود الثايرونين, T3 أو  العكسي, أو rT3) هو [[تصاوغ|مصاوغ]] ل[[ثلاثي يود الثيرونين]].<ref>{{استشهاد ويب| مسار = http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2636 | عنوان = معلومات عن ثلاثي يود الثايرونين العكسي على موقع guidetopharmacology.org | ناشر = guidetopharmacology.org| مسار أرشيف = https://web.archive.org/web/20170808155540/http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2636 | تاريخ أرشيف = 8 أغسطس 2017 }}</ref><ref>{{استشهاد ويب| مسار = http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=1S/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22) | عنوان = معلومات عن ثلاثي يود الثايرونين العكسي على موقع chemapps.stolaf.edu | ناشر = chemapps.stolaf.edu| مسار أرشيف = https://web.archive.org/web/20180630140740/http://chemapps.stolaf.edu/jmol/jmol.php | تاريخ أرشيف = 30 يونيو 2018 }}</ref><ref>{{استشهاد ويب| مسار = https://pubchem.ncbi.nlm.nih.gov/compound/22069 | عنوان = معلومات عن ثلاثي يود الثايرونين العكسي على موقع pubchem.ncbi.nlm.nih.gov | ناشر = pubchem.ncbi.nlm.nih.gov| مسار أرشيف = https://web.archive.org/web/20180920174544/https://pubchem.ncbi.nlm.nih.gov/compound/22069 | تاريخ أرشيف = 20 سبتمبر 2018 }}</ref>

== التفاعل ==
[[ملف:Iodothyronine deiodinase.png|تصغير|يمين|400px|اصطناع ثلاثي يود الثيروكسين العكسي من T<sub>4</sub> عن طريق نزع اليود. يظهر ايضا اصطناع ال[[ثلاثي يود الثيرونين|T<sub>3</sub>]] وال[[Diiodothyronine|T<sub>2</sub>]].]]{{تحديد|left}}

== مراجع ==
{{مراجع}}
== روابط خارجية ==
* {{اسم نظام فهرسة المواضيع الطبية|Triiodothyronine, Reverse}}
{{معرفات مركب كيميائي}}
{{مصادر طبية}}
{{شريط بوابات|الكيمياء الحيوية|الكيمياء}}


{{بذرة كيمياء}}
{{روابط شقيقة}}

[[تصنيف:غدة درقية]]
[[تصنيف:مشتقات التايروسين الميودن]]