عرض مصدر ميتانسين

{{يتيمة|تاريخ=أبريل 2016}}
{{معلومات كيمياء
| Verifiedfields = changed
| verifiedrevid = 387461214
|صورة=Maytansine structure.svg
|حجم صورة=200px
|الاسم النظامي=
|اسماء أخرى=Maytansin
|قسم1={{معلومات كيمياء - معرفات
|  CASNo_Ref = {{cascite|correct|??}}
| CASNo=35846-53-8 
|  PubChem=5281828
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 488931
|  UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 14083FR882
| SMILES=C/C(CC1=CC(OC)=C(Cl)C(N3C)=C1)=C\C=C\[C@@H](OC)[C@@]2(O)C[C@]([C@@H](C)[C@H]4[C@](O4)(C)[C@@H](OC([C@H](C)N(C)C(C)=O)=O)CC3=O)([H])OC(N2)=O
  }}
|قسم2={{معلومات كيمياء - خواص
|  Formula=C<sub>34</sub>H<sub>46</sub>ClN<sub>3</sub>O<sub>10</sub>
|  MolarMass=692.20 g/mol
|  Appearance=
|  Density=
|  MeltingPt=
|  BoilingPt=
|  Solubility=
  }}
|قسم3={{معلومات كيمياء - مخاطر
|  MainHazards=
|  FlashPt=
|  Autoignition=
  }}
}}
'''ميتانسين''' هي مادة [[سمية للخلايا|سام للخلايا]].<ref name="NCI">[https://www.cancer.gov/publications/dictionaries/cancer-drug/def/maytansine?redirect=true National Cancer Institute: Definition of Maytansine] {{Webarchive|url=https://web.archive.org/web/20090509162810/http://www.cancer.gov/Templates/drugdictionary.aspx?CdrID=39492 |date=09 مايو 2009}}</ref> تركيبه الكيميائي يشير إلى أنه ينتمي إلى مجموعة [[ماكروليد]].<ref name="NCI" />

من أهم مشتقاته هي ال[[ميتانسينويد|ميتانسينويدات]].<ref>{{استشهاد بدورية محكمة | الأخير1 = Yu | الأول1 = T.-W. | الأخير2 = Bai | الأول2 = L | الأخير3 = Clade | الأول3 = D | الأخير4 = Hoffmann | الأول4 = D | الأخير5 = Toelzer | الأول5 = S | last6 = Trinh | first6 = KQ | last7 = Xu | first7 = J | last8 = Moss | first8 = SJ | last9 = Leistner | first9 = E | عنوان = The biosynthetic gene cluster of the maytansinoid antitumor agent ansamitocin from Actinosynnemapretiosum | صحيفة = Proceedings of the National Academy of Sciences | المجلد = 99 | العدد = 12 | صفحات = 7968–7973 | سنة = 2002 | pmid = 12060743 | pmc = 123004 | doi = 10.1073/pnas.092697199 }}</ref>