عرض مصدر لاکتوسین

{{يتيمة|تاريخ=يناير 2022}}
{{معلومات كيمياء
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424893309
| صورة=Lactucin.png
| حجم صورة=150px
| التسمية المفضلة = (3a''R'',4''S'',9a''S'',9b''R'')-4-Hydroxy-9-(hydroxymethyl)-6-methyl-3-methylidene-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-''b'']furan-2,7-dione
| أسماء أخرى =
|قسم1={{معلومات كيمياء - معرفات
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=1891-29-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = R6E2918904
| PubChem=821383
| KEGG_Ref = {{keggcite|changed}}
| KEGG = C09489
| ChEBI_Ref = {{ebicite|changed|EBI}} 
| ChEBI = 6358
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 717609
| SMILES = CC1=C2[C@@H]([C@@H]3[C@@H]([C@@H](C1)O)C(=C)C(=O)O3)C(=CC2=O)CO
| InChI = 1/C15H16O5/c1-6-3-9(17)12-7(2)15(19)20-14(12)13-8(5-16)4-10(18)11(6)13/h4,9,12-14,16-17H,2-3,5H2,1H3/t9-,12-,13+,14+/m1/s1
| InChIKey = VJQAFLAZRVKAKM-QQUHWDOBBA
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H16O5/c1-6-3-9(17)12-7(2)15(19)20-14(12)13-8(5-16)4-10(18)11(6)13/h4,9,12-14,16-17H,2-3,5H2,1H3/t9-,12-,13+,14+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = VJQAFLAZRVKAKM-QQUHWDOBSA-N
  }}
|قسم2={{معلومات كيمياء - خواص
| Formula=[[C15H16O5|C<sub>15</sub>H<sub>16</sub>O<sub>5</sub>]]
| MolarMass=276.28 g/mol
| Appearance=White crystalline solid
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
  }}
|قسم3={{معلومات كيمياء - مخاطر
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}
'''لاکتوسین''' مادة مريرة المذاق والتي تقوم بتشكيل بلوريات صلبة وبيضاءة اللون، ينتمي اللاكتوسين لمجموعة   [[سيسكويتربين لاكتون]]. تتواجد هذه المادة في البعض من أنواع [[خس|الخس]] وهو أحد مكونات لاكتوكاريوم . يتبين أنه يوجد خصائص [[مسكن ألم|مسكنة]] و[[مهدئ|مهدئة]] لهذه المادة. <ref>{{استشهاد بدورية محكمة
| عنوان = Analgesic and Sedative Activities of Lactucin and some Lactucin-Like Guaianolides in Mice
| صحيفة = Journal of Ethnopharmacology
| سنة = 2006
| المجلد = 107
| العدد = 2
| صفحات = 254–258
| PMID = 16621374
| DOI = 10.1016/j.jep.2006.03.003
}}</ref> كما وأظهرت هذه المادة بعض التأثيرات [[مضادات الملاريا|المضادة للملاريا.]] <ref>{{استشهاد بدورية محكمة
| عنوان = Antimalarial Activity of Lactucin and Lactucopicrin: Sesquiterpene Lactones Isolated from ''Cichorium intybus'' L.
| صحيفة = Journal of Ethnopharmacology
| سنة = 2004
| المجلد = 95
| العدد = 2–3
| صفحات = 455–457
| PMID = 15507374
| DOI = 10.1016/j.jep.2004.06.031
}}</ref> تتواجد هذه المادة أيضًا في قهوة الهندباء .

تعمل هذه المادة بمثابة [[ناهض (علم الأدوية)|ناهض]] [[مستقبلات الأدينوزين|لمستقبلات الأدينوزين]] . <ref>{{استشهاد بدورية محكمة
| الأخير = Qasem
| الأول = Jamal R
| تاريخ = 2015-04-01
| عنوان = Prospects of wild medicinal and industrial plants of saline habitats in the Jordan Valley
| مسار = https://www.researchgate.net/publication/275339308
| صحيفة = Pakistan Journal of Botany
| المجلد = 47
| العدد = 2
| issn = 0556-3321
| مسار أرشيف = https://web.archive.org/web/20211030070851/https://www.researchgate.net/publication/275339308_Prospects_of_wild_medicinal_and_industrial_plants_of_saline_habitats_in_the_Jordan_Valley | تاريخ أرشيف = 30 أكتوبر 2021 }}</ref>