عرض مصدر كولشيسين

{{صندوق معلومات دواء
| الاسم = كولشيسين
| verifiedrevid = 451415669
| IUPAC_name = ''N''-[(7''S'')-1,2,3,10-Tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[''a'']heptalen-7-yl]acetamide
| image = Colchicine2DACS.svg
| alt = Skeletal formula of colchicine
| width = 200،px
| image2 = Colchicine-3D-balls.png
| alt2 = Ball-and-stick model of the colchicine molecule
| width2 = 220px

<!--Clinical data-->
| tradename = Colcrys
| Drugs.com = {{drugs.com|monograph|colchicine}}
| MedlinePlus = a682711
| pregnancy_AU = D
| pregnancy_US = C
| legal_AU = S4
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
| bioavailability = 45%
| protein_bound = 34-44%
| metabolism = Metabolism, partly by [[سيتوكروم 3A4]]
| elimination_half-life = 26.6-31.2 hours
| excretion = Faeces (65%)

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 64-86-8
| ATC_prefix = M04
| ATC_suffix = AC01
| PubChem = 6167
| IUPHAR_ligand = 2367
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01394
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5933
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SML2Y3J35T
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00570
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27882
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 107

<!--Chemical data-->
| C=22 | H=25 | N=1 | O=6
| molecular_weight = 399.437
| smiles = O=C(N[C@@H]3C\1=C\C(=O)C(\OC)=C/C=C/1c2c(cc(OC)c(OC)c2OC)CC3)C
| InChI = 1/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IAKHMKGGTNLKSZ-INIZCTEOSA-N
}}

'''الكولشيسين''' مركب دوائي مستخلص من [[زهور (توضيح)|زهور]] نبات [[لحلاح خريفي|اللحلاح الخريفي]] {{اسم علمي|Colchicum autumnale}} يستخدم لمعالجة مرض [[نقرس|النقرس]] و[[مرض بهجت|داء بهجت]] و[[داء البروسيلات|حمى البحر الأبيض المتوسط]].<ref>{{استشهاد بدورية محكمة |مؤلف1=Cerquaglia C. |مؤلف2=Diaco M. |مؤلف3=Nucera G. |مؤلف4=La Regina M. |مؤلف5=Montalto M. |مؤلف6=Manna R. | عنوان=Pharmacological and clinical basis of treatment of Familial Mediterranean Fever (FMF) with colchicine or analogues: an update | صحيفة=Current drug targets: inflammation and allergy | المجلد=4 | العدد=1 | صفحات=117–24 | تاريخ=February 2005 | pmid=15720245 | doi=10.2174/1568010053622984 | مسار= https://www.bentham-direct.org/app000026/|مسار أرشيف= https://web.archive.org/web/20081211064412/http://www.bentham-direct.org:80/pages/content.php?CDTIA/2005/00000004/00000001/0019L.SGM|تاريخ أرشيف=2008-12-11}}</ref><ref>[http://biotech.icmb.utexas.edu/botany/colch.html Cyberbotanica: Colchicine<!-- Bot generated title -->] {{Webarchive|url=https://web.archive.org/web/20101205080442/http://biotech.icmb.utexas.edu/botany/colch.html |date=12 2يناير0 }}</ref><ref>{{استشهاد ويب | مسار=https://www.bloomberg.com/news/articles/2015-10-06/2-000-drug-price-surge-is-a-side-effect-of-fda-safety-program | عنوان=2,000% Drug Price Surge Is a Side Effect of FDA Safety Program | ناشر=Bloomberg | تاريخ=6 October 2015 | تاريخ الوصول=27 October 2015 | مؤلف1=Langreth, Robert | مؤلف2=Koons, Cynthia| مسار أرشيف = https://web.archive.org/web/20171206072920/https://www.bloomberg.com/news/articles/2015-10-06/2-000-drug-price-surge-is-a-side-effect-of-fda-safety-program | تاريخ أرشيف = 06 ديسمبر 2017 }}</ref>