عرض مصدر كافيين

{{صندوق معلومات دواء
| verifiedrevid = 
| drug_name = Caffeine ({{اختص|INN|International Nonproprietary Name}})
| IUPAC_name = 1,3,7-Trimethylpurine-2,6-dione<!--Refs: Pubchem & IUPHAR ligand-->
| image = Koffein - Caffeine.svg
| alt = 2D structure of caffeine
| image2 = Caffeine (1) 3D ball.png
| alt2 = 3D structure of caffeine

<!--Clinical data-->| pronounce = {{IPAc-en|k|æ|ˈ|f|i:|n|,_|ˈ|k|æ|f|i:|n|}}
| tradename = 
| Drugs.com = {{Drugs.com|monograph|caffeine-caffeine-and-sodium-benzoate-injection-caffeine-citrate}}
| MedlinePlus = 
| pregnancy_AU = A
| pregnancy_US = C
| legal_AU = Unscheduled
| legal_CA = Unscheduled
| legal_DE = Unscheduled
| legal_NZ = Unscheduled
| legal_UK = Unscheduled
| legal_US = Unscheduled
| legal_EU = Unscheduled
| legal_UN = Unscheduled
| dependency_liability = [[اعتماد جسدي]]: ضعيف-متوسط<ref name="Nestler caffeine dependence-addiction">{{استشهاد بكتاب | مؤلف = Malenka RC, Nestler EJ, Hyman SE | محرر = Sydor A, Brown RY | عنوان = Molecular Neuropharmacology: A Foundation for Clinical Neuroscience | سنة = 2009 | ناشر = McGraw-Hill Medical | مكان = New York |ردمك= 9780071481274 | صفحات = 375 | إصدار = 2nd | الفصل = Chapter 15: Reinforcement and Addictive Disorders | اقتباس= Long-term caffeine use can lead to mild physical dependence. A withdrawal syndrome characterized by drowsiness, irritability, and headache typically lasts no longer than a day. True compulsive use of caffeine has not been documented.}}</ref><ref name="DSM-5 definitions + addiction-dependence distinction + Caffeine use disorder">{{استشهاد ويب | مؤلف = American Psychiatric Association | عنوان = Substance-Related and Addictive Disorders | مسار = http://www.dsm5.org/documents/substance%20use%20disorder%20fact%20sheet.pdf | ناشر = American Psychiatric Publishing | تاريخ الوصول = 10 July 2015 | صفحات = 1–2 | تاريخ = 2013 | اقتباس = Substance use disorder in DSM-5 combines the DSM-IV categories of substance abuse and substance dependence into a single disorder measured on a continuum from mild to severe.&nbsp;... Additionally, the diagnosis of dependence caused much confusion. Most people link dependence with “addiction” when in fact dependence can be a normal body response to a substance.&nbsp;... DSM-5 will not include caffeine use disorder, although research shows that as little as two to three cups of coffee can trigger a withdrawal effect marked by tiredness or sleepiness. There is sufficient evidence to support this as a condition, however it is not yet clear to what extent it is a clinically significant disorder.| مسار أرشيف = https://web.archive.org/web/20161120125106/http://www.dsm5.org/documents/substance use disorder fact sheet.pdf | تاريخ أرشيف = 20 نوفمبر 2016 }}</ref><ref name="CRC Press">{{استشهاد بكتاب|عنوان=Introduction to Pharmacology Third Edition|تاريخ=2007|ناشر=CRC Press|مكان=Abingdon|ردمك=9781420047424|صفحات=222–223|مسار= https://books.google.ca/books?id=qfrLBQAAQBAJ&pg=PA222|مسار أرشيف= https://web.archive.org/web/20200126001852/https://books.google.ca/books?id=qfrLBQAAQBAJ&pg=PA222|تاريخ أرشيف=2020-01-26}}</ref><br />[[اعتماد نفسي]]: ضعيف جداً<ref name="DSM-5 definitions + addiction-dependence distinction + Caffeine use disorder"/>
| addiction_liability = Low<ref name="CRC Press"/> / None<ref name="Nestler caffeine dependence-addiction"/><ref name="DSM-5 definitions + addiction-dependence distinction + Caffeine use disorder"/>
| routes_of_administration = [[إعطاء فموي]]، [[نفخ (طب)]]، [[حقنة القهوة الشرجية|شرجي]]، [[تحميلة (دواء)|تحميلة]]، [[معالجة وريدية|علاج عن طريق الوريد]]، [[دواء موضعي]]، [[جلدي]]
<!--Pharmacokinetic data-->| onset = ~1 hour<ref name = "Poleszak 2015"/>
| bioavailability = 99%<ref name = "Poleszak 2015"/>
| protein_bound = 25–36%<ref name="Drugbank-Caffeine"/>
| metabolism = أولى: [[سيتوكروم بي450]]<ref name="Drugbank-Caffeine"/><br />ثانوي: [[سيتوكروم 2إي1]],<ref name="Drugbank-Caffeine"/> [[سيتوكروم 3A4]],<ref name="Drugbank-Caffeine"/> [[CYP2C8]],<ref name="Drugbank-Caffeine"/> [[سيتوكروم بي450]]<ref name="Drugbank-Caffeine"/>
| elimination_half-life = للبالغين: 3–7&nbsp;ساعة<ref name="Drugbank-Caffeine">{{استشهاد ويب | عنوان=Caffeine | مسار=https://go.drugbank.com/drugs/DB00201#pharmacology | عمل=DrugBank | ناشر= University of Alberta | تاريخ الوصول=8 August 2014 | تاريخ=16 September 2013| مسار أرشيف = https://web.archive.org/web/20190517015549/https://www.drugbank.ca/drugs/DB00201 | تاريخ أرشيف = 17 مايو 2019 }}</ref><br />لحديثي الولادة: 65–130&nbsp;ساعة<ref name="Drugbank-Caffeine"/>
| excretion = البول (100%)
| duration_of_action = 3-4 hours<ref name="Poleszak 2015">{{استشهاد بدورية محكمة|مؤلف1-الأخير=Poleszak|مؤلف1-الأول=Ewa|مؤلف2-الأخير=Szopa|مؤلف2-الأول=Aleksandra|مؤلف3-الأخير=Wyska|مؤلف3-الأول=Elżbieta|مؤلف4-الأخير=Kukuła-Koch|مؤلف4-الأول=Wirginia|مؤلف5-الأخير=Serefko|مؤلف5-الأول=Anna|مؤلف6-الأخير=Wośko|مؤلف6-الأول=Sylwia|مؤلف7-الأخير=Bogatko|مؤلف7-الأول=Karolina|مؤلف8-الأخير=Wróbel|مؤلف8-الأول=Andrzej|مؤلف9-الأخير=Wlaź|مؤلف9-الأول=Piotr|عنوان=Caffeine augments the antidepressant-like activity of mianserin and agomelatine in forced swim and tail suspension tests in mice|صحيفة=Pharmacological Reports|تاريخ=July 2015|doi=10.1016/j.pharep.2015.06.138|مسار= https://www.sciencedirect.com/science/article/abs/pii/S1734114015002637|تاريخ الوصول=12 September 2015|مسار أرشيف= https://web.archive.org/web/20170208154616/http://www.sciencedirect.com/science/article/pii/S1734114015002637|تاريخ أرشيف=2017-02-08}}</ref>
| metabolites = [[Paraxanthine]] (84%)<br />[[ثيوبرومين]] (12%)<br />[[تيوفيلين]] (4%)

<!--Identifiers-->| CAS_number_Ref = {{Cascite|correct|??}}
| CAS_number = 58-08-2
| ATC_prefix = N06B
| ATC_suffix = C01
| PubChem = 2519
| DrugBank_Ref = {{Drugbankcite|correct|drugbank}}
| DrugBank = DB00201
| ChemSpiderID_Ref = {{Chemspidercite|correct|chemspider}}
| ChemSpiderID = 2424
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = 3G6A5W338E
| KEGG_Ref = {{Keggcite|correct|kegg}}
| KEGG = D00528
| ChEBI_Ref = {{Ebicite|correct|EBI}}
| ChEBI = 27732
| ChEMBL_Ref = {{Ebicite|correct|EBI}}
| ChEMBL = 113
| PDB_ligand = CFF
| IUPHAR_ligand = 407
| synonyms = غوارانَين<!--Pubchem--><br />Methyltheobromine<!--Pubchem--><br />1,3,7-Trimethylxanthine<!--Pubchem--><br />Theine

<!--Chemical data-->| C = 8
| H = 10
| N = 4
| O = 2
| molecular_weight = 194.19&nbsp;g/mol
| smiles = CN1C=NC2=C1C(=O)N(C(=O)N2C)C
| InChI = 1/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3
| InChIKey = RYYVLZVUVIJVGH-UHFFFAOYAW
| StdInChI_Ref = 
| StdInChI = 1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3
| StdInChIKey_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChIKey = RYYVLZVUVIJVGH-UHFFFAOYSA-N

<!--Chemical data-->| density = 1.23<!--Reference:<ref>{{استشهاد ويب|مسار=http://www.ilo.org/legacy/english/protection/safework/cis/products/icsc/dtasht/_icsc04/icsc0405.htm |عنوان=Caffeine |ناشر=International Occupational Safety and Health Information Centre (CIS)| مسار أرشيف = http://web.archive.org/web/20111231030423/http://www.ilo.org:80/legacy/english/protection/safework/cis/products/icsc/dtasht/_icsc04/icsc0405.htm | تاريخ أرشيف = 31 ديسمبر 2011 }}</ref>-->
| solubility = <!--This field will append "&nbsp;mg/mL (20&nbsp;°C)" to the end of any value-->
| melting_point = 235
| melting_high = 238 <!--Ref:Pubchem-->
| melting_notes = ([[لامائي]])<ref name="Pubchem properties">{{استشهاد ويب|عنوان=Caffeine|مسار=http://www.chemspider.com/Chemical-Structure.2424.html|موقع=ChemSpider|ناشر=Royal Society of Chemistry|تاريخ الوصول=16 October 2014|اقتباس=Experimental Melting Point:<br />234–236&nbsp;°C Alfa Aesar<br />237&nbsp;°C Oxford University Chemical Safety Data<br />238&nbsp;°C LKT Labs [C0221]<br />237&nbsp;°C Jean-Claude Bradley Open Melting Point Dataset 14937<br />238&nbsp;°C Jean-Claude Bradley Open Melting Point Dataset 17008, 17229, 22105, 27892, 27893, 27894, 27895<br />235.25&nbsp;°C Jean-Claude Bradley Open Melting Point Dataset 27892, 27893, 27894, 27895<br />236&nbsp;°C Jean-Claude Bradley Open Melting Point Dataset 27892, 27893, 27894, 27895<br />235&nbsp;°C Jean-Claude Bradley Open Melting Point Dataset 6603<br />234–236&nbsp;°C Alfa Aesar A10431, 39214<br />Experimental Boiling Point:<br />178&nbsp;°C (Sublimes) Alfa Aesar<br />178&nbsp;°C (Sublimes) Alfa Aesar 39214
| مسار أرشيف = https://web.archive.org/web/20190514141609/http://www.chemspider.com/Chemical-Structure.2424.html | تاريخ أرشيف = 14 مايو 2019 }}</ref><ref name="Pubchem properties" />
| boiling_point = <!--178 Ref:Pubchem-->
| boiling_notes = <!--([[تسامي]])-->
}}
'''الكافيين''' أو '''البُنِّين'''<ref>{{استشهاد بويكي بيانات|Q113297966|صفحة=231}}</ref> هو مادة [[شبه قلوي]]ة من مجموعة [[زانثين|الزانتينات]] تُصنف ضمن [[دواء نفسي المفعول|العقاقير نفسانية التأثير]] من مجموعة [[منبه (مادة)|منبهات]].<ref>{{استشهاد ويب
| مسار = https://www.caffeineinformer.com/caffeine-trimethylxanthine
| عنوان = Caffeine: Facts, Usage, and Side Effects
| موقع = www.caffeineinformer.com
| لغة = en-us
| تاريخ الوصول = 2022-01-18
| مسار أرشيف = https://web.archive.org/web/20211211224340/https://www.caffeineinformer.com/caffeine-trimethylxanthine | تاريخ أرشيف = 11 ديسمبر 2021 }}</ref><ref>{{استشهاد ويب
| مسار = https://adf.org.au/drug-facts/caffeine/
| عنوان = Caffeine - Alcohol and Drug Foundation
| موقع = adf.org.au
| لغة = en
| تاريخ الوصول = 2022-01-18
| مسار أرشيف = https://web.archive.org/web/20220111221032/https://adf.org.au/drug-facts/caffeine/ | تاريخ أرشيف = 11 يناير 2022 }}</ref><ref>{{استشهاد ويب
| مسار = https://www.healthline.com/health/caffeine-effects-on-body
| عنوان = The Effects of Caffeine on Your Body
| تاريخ = 2017-07-31
| موقع = Healthline
| لغة = en
| تاريخ الوصول = 2022-01-18
| مسار أرشيف = https://web.archive.org/web/20211211222724/https://www.healthline.com/health/caffeine-effects-on-body | تاريخ أرشيف = 11 ديسمبر 2021 }}</ref>

يعمل الكافيين [[منبه (مادة)|منبهاً]] ل[[جهاز عصبي مركزي|لجهاز العصبي المركزي]] عند [[إنسان|البشر]] حيث أنه يجدد [[نشاطية|النشاط]] مؤقتاً. ويعتبر [[شاي|الشاي]] و[[قهوة عربية|القهوة العربية]] ومشروبات [[كولا|الكولا]] و[[مشروب كحولي يحتوي على الكافيين|المشروبات الكحولية المحتوية على الكافيين]] غنية بالكافيين.

هي مادة شبه قلوية معروفة بالأبيض المر، فمادة الميثيلكسانثين الشبه قلوية تتألف من ثلاث مركبات: الكافيين والثيوفيلين والثيوبرومين، والتي توجد في القهوة والشاي وبذور بعض النباتات حيث أنها تعمل مبيداتٍ طبيعيةً للآفات، فتشلُّ وتقتل بعض الحشرات التي تتغذى على هذه النباتات بحَسَب ما تذكره الصيدليات الفرنسية في اكتشافها عام 1821م. ويشير العالم بللوتيه إلى أن الكافيين لا تصنف ضمن المخدرات، و لهذه المادة تأثيراتٌ كيميائية وحيوية تُرَاوح بين نسبٍ مختلفة على البشر.