عرض مصدر سولينداك

{{وصلات قليلة|تاريخ=أبريل 2016}}
{{صندوق معلومات دواء
| Verifiedfields = changed
| verifiedrevid = 402677877
| IUPAC_name = {(1''Z'')-5-fluoro-2-methyl-1-[4-(methylsulfinyl)benzylidene]-1H-indene-3-yl}acetic acid
| image= Sulindac structure.svg
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 1265915
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 184SNS8VUH
| InChI = 1/C20H17FO3S/c1-12-17(9-13-3-6-15(7-4-13)25(2)24)16-8-5-14(21)10-19(16)18(12)11-20(22)23/h3-10H,11H2,1-2H3,(H,22,23)/b17-9-
| InChIKey = MLKXDPUZXIRXEP-MFOYZWKCBF
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1376
| smiles = O=S(c1ccc(cc1)\C=C3/c2ccc(F)cc2\C(=C3C)CC(=O)O)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H17FO3S/c1-12-17(9-13-3-6-15(7-4-13)25(2)24)16-8-5-14(21)10-19(16)18(12)11-20(22)23/h3-10H,11H2,1-2H3,(H,22,23)/b17-9-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MLKXDPUZXIRXEP-MFOYZWKCSA-N
| CAS_number= 38194-50-2
| ATC_prefix= M01
| ATC_suffix= AB02
| PubChem = 1548887
| DrugBank= APRD01243
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D00120
| C = 20 | H = 17 | F = 1 | O = 3 | S = 1
| molecular_weight = 356.412 g/mol
| bioavailability = Approximately 90% (Oral)
| metabolism = ?
| elimination_half-life= 7.8 hours, metabolites up to 16.4 hours
| excretion = [[كلية (توضيح)|Renal]] (50%) and fecal (25%)
| pregnancy_AU = C
| pregnancy_US = C
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = Oral
}}
'''سولينداك''' هو من مضادات الالتهاب اللاستيرويدية يستخدم كمسكن للآلام وخافض حرارة وفي [[التهاب المفاصل|التهابات المفاصل]] المزمنة.<ref>{{استشهاد ويب|الأخير=Thomas|الأول=Katie|عنوان=Justices to Take Up Case on Generic Drug Markers' Liability|مسار=https://www.nytimes.com/2013/03/05/business/justices-to-take-up-case-on-generic-drug-makers-liability.html?pagewanted=all&_r=0|ناشر=New York Times|تاريخ الوصول=4 March 2013| مسار أرشيف = https://web.archive.org/web/20170904203949/http://www.nytimes.com/2013/03/05/business/justices-to-take-up-case-on-generic-drug-makers-liability.html?pagewanted=all&_r=0 | تاريخ أرشيف = 04 سبتمبر 2017 }}</ref><ref>{{استشهاد بدورية محكمة | doi = 10.1021/jo00431a019| عنوان = A sterically efficient synthesis of (Z)-5-fluoro-2-methyl-1-(p-methylthiobenzylidene)-3-indenylacetic acid and its S-oxide, sulindac| صحيفة = The Journal of Organic Chemistry| المجلد = 42| العدد = 11| صفحات = 1914| سنة = 1977| الأخير1 = Shuman | الأول1 = R. F. | الأخير2 = Pines | الأول2 = S. H. | الأخير3 = Shearin | الأول3 = W. E. | الأخير4 = Czaja | الأول4 = R. F. | الأخير5 = Abramson | الأول5 = N. L. | الأخير6 = Tull | الأول6 = R. }}</ref><ref>{{استشهاد بدورية محكمة |عدة مؤلفين=Scheper MA, Nikitakis NG, Chaisuparat R, Montaner S, Sauk JJ |عنوان=Sulindac induces apoptosis and inhibits tumor growth in vivo in head and neck squamous cell carcinoma |صحيفة=Neoplasia |المجلد=9 |العدد=3 |صفحات=192–9 |تاريخ=March 2007 |pmid=17401459 |pmc=1838577 |مسار= https://www.sciencedirect.com/journal/neoplasia |doi=10.1593/neo.06781|مسار أرشيف= https://web.archive.org/web/20120311094451/http://www.neoplasia.com/abstract.php?msid=1062|تاريخ أرشيف=2012-03-11}}</ref>