عرض مصدر ستركنين

{{معلومات كيمياء|Watchedfields=changed|verifiedrevid=470471685|صورة=Strychnine.svg|حجم صورة=180|صورة1=Strychnine-from-xtal-3D-balls.png|الاسم النظامي=|اسماء أخرى=Strychnidin-10-one<ref>Retrieved from SciFinder. [May 7, 2018]</ref>|قسم1={{معلومات كيمياء - معرفات
| IUPHAR_ligand = 347
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 389877
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = H9Y79VD43J
| InChI = 1/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1
| InChIKey = QMGVPVSNSZLJIA-FVWCLLPLBR
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QMGVPVSNSZLJIA-FVWCLLPLSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=57-24-9
| CASNo_Comment = (base)
| CASNo1_Ref = {{cascite|correct|??}}
| CASNo1 = 60-41-3
| CASNo1_Comment = (sulfate)
| PubChem = 441071
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 227934
| ChEMBL2_Ref = {{ebicite|correct|EBI}}
| ChEMBL2 = 612118
| ChEMBL3_Ref = {{ebicite|correct|EBI}}
| ChEMBL3 = 486399
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C06522
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28973
| SMILES = O=C7N2c1ccccc1[C@@]64[C@@H]2[C@@H]3[C@@H](OC/C=C5\[C@@H]3C[C@@H]6N(CC4)C5)C7
| RTECS = WL2275000
| UNNumber = 1692
  }}|قسم2={{معلومات كيمياء - خواص
| C=21 | H=22 | N=2 | O=2
| Odor = Odorless
| Appearance = White or translucent crystal or crystalline powder; Bitter tasting
| Density = 1.36 g cm<sup>−3</sup>
| BoilingPtK = 557 to 559
| MeltingPtK = 543
| pKa = 8.25<ref name="Everett1957">{{استشهاد بدورية محكمة |doi=10.1039/JR9570001120 |عنوان=The constitution of aspidospermine. Part III. Reactivity at the nitrogen atoms, and biogenetic considerations |صحيفة=Journal of the Chemical Society |صفحات=1120–3 |سنة=1957 |الأخير1=Everett |الأول1=A. J. |الأخير2=Openshaw |الأول2=H. T. |الأخير3=Smith |الأول3=G. F. }}</ref>
| Solubility = 0.02% (20&nbsp;°C)<ref name=PGCH/>
  }}|قسم3={{معلومات كيمياء - مخاطر
| MainHazards = Very toxic
| GHSPictograms = {{جمجمة وعظمتين متقاطعتين}}{{بيئة GHS}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|300|310|330|410}}
| PPhrases = {{P-phrases|260|264|273|280|284|301+310}}
| NFPA-H = 4
| NFPA-F = 0
| NFPA-R = 0
| FlashPt = Non flammable.
| AutoignitionPt = Non flammable.
| IDLH = 3 mg/m<sup>3</sup><ref name=PGCH>{{PGCH|0570}}</ref>
| PEL = TWA 0.15 mg/m<sup>3</sup><ref name=PGCH/>
| REL = TWA 0.15 mg/m<sup>3</sup><ref name=PGCH/>
| LD50 = 0.5 mg/kg (dog, oral)<br />0.5 mg/kg (cat, oral)<br />2 mg/kg (mouse, oral)<br />16 mg/kg (rat, oral)<br />2.35 mg/kg (rat, oral)<ref name=IDLH>{{IDLH|57249|Strychnine}}</ref>
| LDLo = 0.6 mg/kg (rabbit, oral)<ref name=IDLH/>
  }}}}

'''الإستركنين''' هو [[شبه قلوي|قلويد]] [[بلورة|بلوري]] عالي [[تأثير سمي|السمية]]، عديم اللون، [[شبه قلوي|مبلور]] يستخدم [[مبيد آفات|كمبيد للآفات]]، وخاصة لقتل [[فقاريات|الفقاريات]] الصغيرة مثل [[طائر|الطيور]] [[قوارض|والقوارض]]. يتسبب الإستركنين، عند استنشاقه أو ابتلاعه أو امتصاصه من خلال العين أو الفم، في حدوث [[سموم الستركنين|تسمم]] يؤدي إلى [[اختلاج|تشنجات]] عضلية وفي النهاية الوفاة من خلال [[اختناق|الاختناق]].<ref name="sharma">Sharma, R. K., ''Consice textbook of forensic medicine & toxicology'', Elsevier, 2008</ref> في حين أنه ليس له آثار طبية معروفة، في الماضي كان يعتقد أن تأثير التشنج مفيد في الجرعات الصغيرة. المصدر الأكثر شيوعًا هو بذور شجرة [[جوز مقيء]].