عرض مصدر ديكوفول

{{وصلات قليلة|تاريخ =أغسطس 2023}}
{{معلومات كيمياء
| verifiedrevid = 443636501
| صورة = Dicofol chemical structure.png
| حجم صورة = 240
| بديل صورة = Skeletal formula of dicofol
| صورة1 = Dicofol-3D-balls.png
| حجم صورة1 = 220
| بديل صورة1 = Ball-and-stick model of the dicofol molecule
| صورة2 = Dicofol-3D-spacefill.png
| حجم صورة2 = 220
| بديل صورة2 = Space-filling model of the dicofol molecule
| الاسم النظامي=2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol
| أسماء أخرى=
|قسم1={{معلومات كيمياء - معرفات
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 7970
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C14301
| InChI = 1/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H
| InChIKey = UOAMTSKGCBMZTC-UHFFFAOYAZ
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 228511
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UOAMTSKGCBMZTC-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=115-32-2
| PubChem=8268
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W4WMM0WS91
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 34692
| SMILES = Clc1ccc(cc1)C(O)(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
}}
|قسم2={{معلومات كيمياء - خواص
| Formula=C<sub>14</sub>H<sub>9</sub>Cl<sub>5</sub>O
| MolarMass=370.48566
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
  }}
|قسم3={{معلومات كيمياء - مخاطر
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}

'''الديكوفول''' هو مبيد حشري الذي يرتبط كيميائيا ب ددت. الديكوفول فعالة جدا ضد سوس العنكبوت الأحمر.

واحدة من مكوناته المستخدمة في إنتاجه هو ددت. وقد تسبب ذلك في انتقاد العديد من علماء البيئة؛ ومع ذلك، تصنف منظمة الصحة العالمية
الديكوفول كمستوى من المستوى الثاني، «مبيد معتدل الخطورة».<ref name="who.int">[https://www.who.int/ipcs/publications/pesticides_hazard/en/ WHO | The WHO Recommended Classification of Pesticides by Hazard<!-- عنوان مولد بالبوت -->] {{Webarchive|url=https://web.archive.org/web/20180227225040/http://www.who.int/ipcs/publications/pesticides_hazard/en/ |date=27 فبراير 2018}}</ref>  ومن المعروف أنها ضارة بالحيوانات المائية.