عرض مصدر حمض الزيت

{{معلومات كيمياء
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 416953907
|   الاسم = حمض الاوليك (حمض الزيتيك)
|   صورة = Oleic-acid-based-on-xtal-1997-2D-skeletal.png
|   حجم صورة = 250px
|   صورة2 = Oleic-acid-3D-vdW.png
|   حجم صورة2 = 250px 
|   اسم صورة = Oleic acid
|   الاسم النظامي = (9''Z'')-Octadec-9-enoic acid
|   أسماء أخرى = (9''Z'')-Octadecenoic acid<br />(''Z'')-Octadec-9-enoic acid<br />''cis''-9-Octadecenoic acid<br />''cis''-Δ<sup>9</sup>-Octadecenoic acid<br />Oleic acid<br />18:1 cis-9
| قسم1 = {{معلومات كيمياء - معرفات
|   SMILES = CCCCCCCC\C=C/CCCCCCCC(O)=O
|   CASNo_Ref = {{cascite|correct|CAS}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 8659
| CASNo = 112-80-1
|  ChemSpiderID_Ref =
| ChemSpiderID = 393217
|  InChI = 1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-
|  InChIKey = ZQPPMHVWECSIRJ-KTKRTIGZBB
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZQPPMHVWECSIRJ-KTKRTIGZSA-N
|   RTECS = 
}}
| قسم2 = {{معلومات كيمياء - خواص
|   C=18|H=34|O=2
|   Appearance = Pale yellow or brownish yellow oily liquid with lard-like odor
|   Density = 0.895 g/mL
|   Solubility = Insoluble
|   SolubleOther = Soluble
|   Solvent = [[ميثانول]]
|   MeltingPtCL = 13
|   MeltingPtCH = 14
|   BoilingPtC = 360
|   Boiling_notes = <ref>{{استشهاد بدورية محكمة |doi=10.1021/ed079p24 |عنوان=Chemical Laboratory Information Profile: Oleic Acid |سنة=2002 |مؤلف1-الأخير=Young |مؤلف1-الأول=Jay A. |صحيفة=Journal of Chemical Education |المجلد=79 |صفحات=24}}</ref>
|   pKa = 
|   pKb = 
|   Viscosity = 
}}
| قسم3 = {{معلومات كيمياء - بنية
|   MolShape = 
|   Coordination = 
|   CrystalStruct = 
|   Dipole =
}}
| قسم7 = {{معلومات كيمياء - مخاطر
|   ExternalMSDS = [http://hazard.com/msds/mf/baker/baker/files/o3596.htm JT Baker]
|   MainHazards = 
|   FlashPt = 
|   RPhrases = 
|   SPhrases = 
|  NFPA-H = 0
|  NFPA-F = 1
|  NFPA-R = 0
}}
| قسم8 = {{معلومات كيمياء - متعلقة
|   أنيونات أخرى =
|   كتيونات أخرى =
|   مركبات ذات علاقة = 
}}
}}
'''حمض الزيت''' أو '''حمض الأولييك''' هو [[حمض دهني أوميغا-9]] أحادي غير مشبع موجود في مختلف المصادر الحيوانية والنباتية. وله الصيغة C<sub>18</sub>H<sub>34</sub>O<sub>2</sub> (أو CH<sub>3</sub>(CH<sub>2</sub>)<sub>7</sub>CH=CH(CH<sub>2</sub>)<sub>7</sub>COOH)ا.<ref>Bishop, Paul L. (2000). [http://www.eng.uc.edu/~pbishop/Chapter-2-Slides.ppt Pollution Prevention: Chapter 2 - Properties and Fates of Environmental Contaminants], instructional slides to accompany ''Pollution Prevention:Fundamentals and Practice'', by Paul L. Bishop (ISBN 0-07-366147-3). Retrieved 2005-03-07. {{وصلة مكسورة|تاريخ=مايو 2019|bot=JarBot}} {{Webarchive|url=https://web.archive.org/web/20090930230001/http://www.eng.uc.edu/~pbishop/Chapter-2-Slides.ppt|date=30 سبتمبر 2009}}</ref> الشكل المشبع لهذا الحمض هو [[حمض الشمع]].