عرض مصدر حرملول

{{وصلات قليلة|تاريخ=أكتوبر 2021}}
{{معلومات كيمياء
| صورة = Harmalol structure.svg
| حجم صورة =
| بديل صورة = 
| التسمية المفضلة = 1-Methyl-4,9-dihydro-3''H''-pyrido[4,3-''b'']indol-7-ol
| أسماء أخرى = 1-Methyl-4,9-dihydro-3''H''-β-carbolin-7-ol
|قسم1={{معلومات كيمياء - معرفات
| CASNo = 525-57-5
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2NQN80556Q
| PubChem = 5353656
| EINECS = 208-375-4
| ChemSpiderID = 11262879
| SMILES = OC1=CC=C(C(CCN=C3C)=C3N2)C2=C1
| StdInChI = 1S/C12H12N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-3,6,14-15H,4-5H2,1H3
| StdInChIKey = RHVPEFQDYMMNSY-UHFFFAOYSA-N}}
|قسم2={{معلومات كيمياء - خواص
| C=12 | H=12 | N=2 | O=1
| MolarMass = 
| Appearance = Red solid
| Density = 
| MeltingPtC = 100 to 105
| MeltingPt_notes = (trihydrate)<ref>Thieme Chemistry (Hrsg.): RÖMPP Online – Version 3.37. Georg Thieme Verlag KG, Stuttgart, 27. September 2013.</ref>
| BoilingPt = 
| Solubility = }}
|قسم3={{معلومات كيمياء - مخاطر
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
 }}
}}
'''حرملول''' هو مركب بيتا-كاربولين حيوي و نشط بيولوجيًا ، يعتبر هذا المركب عضو في مجموعة المركبات التي تنتمي ل[[أشباه قلويات الحرمل]]. <ref name="pmid24368411">{{استشهاد بدورية محكمة
| عنوان = Binding of alkaloid harmalol to DNA: photophysical and calorimetric approach.
| صحيفة = J Photochem Photobiol B
| سنة = 2014
| المجلد = 130
| صفحات = 272–80
| DOI = 10.1016/j.jphotobiol.2013.11.021
| PMID = 24368411
}}</ref> <ref name="pmid22037238">{{استشهاد بدورية محكمة
| عنوان = Harmaline and harmalol inhibit the carcinogen-activating enzyme CYP1A1 via transcriptional and posttranslational mechanisms.
| صحيفة = Food Chem Toxicol
| سنة = 2012
| المجلد = 50
| العدد = 2
| صفحات = 353–62
| PMID = 22037238
| DOI = 10.1016/j.fct.2011.10.052
| PMCID = 3281145
}}</ref>