عرض مصدر ثيوفيلين

{{صندوق معلومات دواء| verifiedrevid = 470606142
| IUPAC_name = 1,3-dimethyl-7H-purine-2,6-dione
| image = Theophyllin_-_Theophylline.svg
| width = 167
| image2 = Theophylline-3D-balls.png

<!--Clinical data-->
| tradename = Theolair, Slo-Bid
| Drugs.com = {{Drugs.com|monograph|theophyllines}}
| MedlinePlus = a681006
| pregnancy_AU = A
| pregnancy_US = C
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK = P
| legal_US = Rx
| legal_status =
| routes_of_administration = oral, [[معالجة وريدية|IV]], rectal

<!--Pharmacokinetic data-->
| bioavailability = 100%
| protein_bound = 40%, primarily to albumin
| metabolism = [[كبد]] to 1-methyluric acid
| elimination_half-life = 5-8 hours

<!--Identifiers-->
| CASNo_Ref = {{Cascite|correct|CAS}}
| CAS_number_Ref = {{Cascite|correct|??}}
| CAS_number = 58-55-9
| ATC_prefix = R03
| ATC_suffix = DA04
| ATC_supplemental =
| ChEBI_Ref = {{Ebicite|correct|EBI}}
| ChEBI = 28177
| PubChem = 2153
| IUPHAR_ligand = 413
| DrugBank_Ref = {{Drugbankcite|correct|drugbank}}
| DrugBank = DB00277
| ChemSpiderID_Ref = {{Chemspidercite|correct|chemspider}}
| ChemSpiderID = 2068
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = 0I55128JYK
| KEGG_Ref = {{Keggcite|correct|kegg}}
| KEGG = D00371
| ChEMBL_Ref = {{Ebicite|correct|EBI}}
| ChEMBL = 190

<!--Chemical data-->
| C=7 | H=8 | N=4 | O=2
| molecular_weight = 180.164 g/mol
| smiles = Cn1c2c(c(=O)n(c1=O)C)[nH]cn2
| InChI = 1/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9)
| StdInChI_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChI = 1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9)
| StdInChIKey_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChIKey = ZFXYFBGIUFBOJW-UHFFFAOYSA-N
}}
'''تيوفيلين''' أو '''ثيوفيلين''' {{إنج|Theophylline}} ويعرف أيضا باسم '''ديمثيلكسانثين-3''' {{إنج|3-dimethylxanthine}}، يتنمي إلى ال[[مجموعة ميثيل|ميثيل]] وهو دواء يستخدم في علاج [[مرض تنفسي|أمراض الجهاز التنفسي]] مثل [[داء الانسداد الرئوي المزمن|مرض الانسداد الرئوي المزمن]] و[[ربو|الربو]].