عرض مصدر تولميتين

{{صندوق معلومات دواء
| Verifiedfields = changed
| verifiedrevid = 470611535
| IUPAC_name = [1-methyl-5-(4-methylbenzoyl)-1''H''-pyrrol-2-yl]acetic acid
| image = Tolmetin.svg
| alt = Skeletal formula
| image2 = Tolmetin-3D-spacefill.png
| alt2 = Space-filling model

<!--Clinical data-->
| tradename = Tolectin
| Drugs.com = {{drugs.com|monograph|tolectin}}
| MedlinePlus = a681033
| pregnancy_category =  
| legal_AU = S4
| legal_status =  
| routes_of_administration = oral

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life = 1-2 hours, next phase up to 5 hours
| excretion =

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 26171-23-3
| ATC_prefix = M01
| ATC_suffix = AB03
| ATC_supplemental =  {{ATC|M02|AA21}}
| PubChem = 5509
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank = DB00500
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5308
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 71941
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = D8K2JPN18B
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02355
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1020

<!--Chemical data-->
| C=15 | H=15 | N=1 | O=3 
| molecular_weight = 257.285 g/mol
| smiles = O=C(c1ccc(n1C)CC(=O)O)c2ccc(cc2)C
| InChI = 1/C15H15NO3/c1-10-3-5-11(6-4-10)15(19)13-8-7-12(16(13)2)9-14(17)18/h3-8H,9H2,1-2H3,(H,17,18)
| InChIKey = UPSPUYADGBWSHF-UHFFFAOYAL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H15NO3/c1-10-3-5-11(6-4-10)15(19)13-8-7-12(16(13)2)9-14(17)18/h3-8H,9H2,1-2H3,(H,17,18)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UPSPUYADGBWSHF-UHFFFAOYSA-N
}}

[[ملف:Tolmetin.png|تصغير|250px]]
'''تولميتين (Tolmetin)''' عقار من [[مضادات الالتهاب غير الستيروئيدية]]، [[مسكن ألم]] و[[خافض حرارة]].<ref>{{استشهاد ويب|عنوان =Tolmetin|ناشر = DrugBank|تاريخ الوصول = 2007-07-02|مسار = https://go.drugbank.com/drugs/DB00500|مسار أرشيف= https://web.archive.org/web/20191215120142/https://www.drugbank.ca/drugs/DB00500|تاريخ أرشيف=2019-12-15}}</ref><ref>{{استشهاد بدورية محكمة | الأخير1 = Stacher | الأول1 = G | الأخير2 = Bauer | الأول2 = P | الأخير3 = Ehn | الأول3 = I | الأخير4 = Schreiber | الأول4 = E | عنوان = Effects of tolmetin, paracetamol, and of two combinations of tolmetin and paracetamol as compared to placebo on experimentally induced pain. A double blind study | صحيفة = International journal of clinical pharmacology and biopharmacy | المجلد = 17 | العدد = 6 | صفحات = 250–5 | سنة = 1979 | pmid = 381221}}</ref><ref>{{استشهاد بدورية محكمة | الأخير1 = Davies | الأول1 = J | الأخير2 = Dixon | الأول2 = AS | الأخير3 = Steele | الأول3 = CE | عنوان = Tolmetin sodium and indomethacin in the treatment of osteoarthrosis of the hip: a double-blind crossover study | مسار = https://archive.org/details/sim_current-medical-research-and-opinion_1980_7_2/page/115 | صحيفة = Current medical research and opinion | المجلد = 7 | العدد = 2 | صفحات = 115–20 | سنة = 1980 | pmid = 7002480 | doi = 10.1185/03007998009112037}}</ref>