عرض مصدر تولازاميد

{{يتيمة|تاريخ=مارس 2016}}

{{معلومات دواء
| verifiedrevid = 408966679
| IUPAC_name = ''N''-[(azepan-1-ylamino)carbonyl]-4-methylbenzenesulfonamide
| image = Tolazamide.svg
| image2 = Tolazamide ball-and-stick.png
<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|monograph|tolazamide}}
| MedlinePlus = a682482
| licence_US = Tolazamide
| pregnancy_AU = C
| pregnancy_US = C
| legal_US = Rx-only
| routes_of_administration = Oral
<!--Pharmacokinetic data-->
| bioavailability = ?
| metabolism = metabolized in the liver to active metabolites
| elimination_half-life = 7 hours
| excretion = [[كلية (توضيح)|Renal]] (85%) and fecal (7%)
<!--Identifiers-->
| IUPHAR_ligand = 6847
| CAS_number = 1156-19-0
| ATC_prefix = A10
| ATC_suffix = BB05
| PubChem = 5503
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00839
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5302
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9LT1BRO48Q
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00379
| ChEBI = 9613
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 817
<!--Chemical data-->
| C=14 | H=21 | N=3 | O=3 | S=1
| molecular_weight = 311.401 g/mol
| SMILES = O=S(=O)(c1ccc(cc1)C)NC(=O)NN2CCCCCC2
| InChI = 1/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18)
| InChIKey = OUDSBRTVNLOZBN-UHFFFAOYAL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OUDSBRTVNLOZBN-UHFFFAOYSA-N
}}
'''تولازاميد''' هو دواء ينتمي لمجموعة [[سلفونيليوريا]] التي تستخدم في علاج [[السكري]] من [[سكري النوع الثاني|النمط الثاني]].<ref>{{استشهاد بدورية محكمة | مؤلف = Wright, J. B.; Willette, R. E. | صحيفة = J. Med. Chem. | سنة = 1962 | المجلد = 5 | صفحات = 815–822 | doi = 10.1021/jm01239a016 | العدد = 4}}</ref><ref>{{استشهاد بدورية محكمة
 | pmid = 14056414
| سنة = 1962
| مؤلف1 = Wright
| مؤلف-الأول1 = J. B.
| عنوان = Antidiabetic Agents. N4-Arylsulfonylsemicarbazides
| صحيفة = Journal of medicinal and pharmaceutical chemistry
| المجلد = 91
| صفحات = 815–22
| مؤلف-الأخير2 = Willette
| مؤلف-الأول2 = R. E.
}}</ref> كان يسوق تحت اسم تجاري هو ''Tolinase'' لكن استخدامه انحسر بسبب توفر أدوية أحدث.