عرض مصدر بي أف-219061

{{وصلات قليلة|تاريخ =مارس 2023}}
{{معلومات دواء
| verifiedrevid = 451228063
| IUPAC_name = (''R'')-3-(4-propylmorpholin-2-yl)phenol
| image = PF-219,061 Structural Formulae.png
| width = 200

| tradename =  
| pregnancy_AU = 
| pregnancy_US = 
| pregnancy_category =  
| legal_AU = 
| legal_UK = 
| legal_US = 
| legal_status =  
| routes_of_administration = Nasal

| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =

| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 710654-74-3
| ATC_prefix =  
| ATC_suffix =  
| PubChem = 9794475
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChemSpiderID      = 7970242

| C=13 | H=19 | N=1 | O=2 
| molecular_weight = 221.295 g/mol
| smiles = CCCN1CCO[C@@H](C1)C2=CC(=CC=C2)O
| InChI             = 1/C13H19NO2/c1-2-6-14-7-8-16-13(10-14)11-4-3-5-12(15)9-11/h3-5,9,13,15H,2,6-8,10H2,1H3/t13-/m0/s1
| InChIKey          = WYEGTIGJSHGEID-ZDUSSCGKBQ
| StdInChI          = 1S/C13H19NO2/c1-2-6-14-7-8-16-13(10-14)11-4-3-5-12(15)9-11/h3-5,9,13,15H,2,6-8,10H2,1H3/t13-/m0/s1
| StdInChIKey       = WYEGTIGJSHGEID-ZDUSSCGKSA-N
}}
'''بي أف-219,061''' {{إنج|PF-219,061}} هي مادة تطورها [[فايزر]] ذات تأثير [[ناهضة (دواء)|ناهض]] قوي وانتقائي تجاه [[مستقبل الدوبامين د3]].<ref>Blagg J, Allerton CM, Batchelor DV, Baxter AD, Burring DJ, Carr CL, Cook AS, Nichols CL, Phipps J, Sanderson VG, Verrier H, Wong S. Design and synthesis of a functionally selective D3 agonist and its in vivo delivery via the intranasal route. ''Bioorganic and Medicinal Chemistry Letters''. 2007 Dec 15;17(24):6691-6. {{دوي|10.1016/j.bmcl.2007.10.059}} {{PMID|17976986}}</ref><ref>Brioni JD, Moreland RB. Dopamine D4 receptors and the regulation of penile erection. ''Drug Discovery Today: Therapeutic Strategies''. 2006;3(4):599-604. {{دوي|10.1016/j.ddstr.2006.10.006}}</ref> تجرى عليها الأبحاث لاحتمال فعاليتها في علاج [[العجز الجنسي الأنثوي]].<ref>[http://www.wipo.int/pctdb/en/wo.jsp?IA=GB2002005595&DISPLAY=STATUS Van Der Graaf et al. SELECTIVE DOPAMINE D3 RECEPTOR AGONISTS FOR THE TREATMENT OF SEXUAL DYSFUNCTION. WIPO Patent WO/2003/051370, granted to Pfizer]{{وصلة مكسورة|تاريخ=مايو 2019 |bot=JarBot }}. {{استشهاد ويب |مسار=https://patentscope.wipo.int/search/en/wo.jsp?IA=GB2002005595&DISPLAY=STATUS |عنوان=نسخة مؤرشفة |تاريخ الوصول=14 أبريل 2020 |تاريخ أرشيف=13 مارس 2020 |مسار أرشيف=https://web.archive.org/web/20200313053832/https://patentscope.wipo.int/search/en/wo.jsp?IA=GB2002005595&DISPLAY=STATUS |حالة المسار=bot: unknown }}</ref><ref>Attkins NJ, Heatherington AC, Phipps J, Verrier H, Huyghe I. Predictability of intranasal pharmacokinetics in man using pre-clinical pharmacokinetic data with a dopamine 3 receptor agonist, PF-219061. ''Xenobiotica''. 2009 Jul;39(7):523-33. {{PMID|19480558}}</ref>