عرض مصدر بروميتون

{{يتيمة|تاريخ=مايو 2022}}
{{معلومات كيمياء
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 432374489
| صورة = Prometon.png
| بديل صورة = Skeletal formula of prometon
| صورة1 = Prometon-3D-balls.png
| حجم صورة1 = 220
| بديل صورة1 = Ball-and-stick model of the prometon molecule
| التسمية المفضلة=6-Methoxy-''N''<sup>2</sup>,''N''<sup>4</sup>-di(propan-2-yl)-1,3,5-triazine-2,4-diamine
| أسماء أخرى=Prometon
|قسم1={{معلومات كيمياء - معرفات
| CASNo_Ref = {{Cascite|correct|CAS}}
| CASNo=1610-18-0
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = DY7SQ0399L
| PubChem=4928
| ChEBI_Ref = {{Ebicite|changed|EBI}} 
| ChEBI = 34934
| ChEMBL_Ref = {{Ebicite|changed|EBI}}
| ChEMBL = 1486524
| KEGG_Ref = {{Keggcite|correct|kegg}}
| KEGG = C14186
| SMILES=CC(C)NC1=NC(=NC(=N1)OC)NC(C)C
| EINECS = 216-548-0
| ChemSpiderID_Ref = {{Chemspidercite|changed|chemspider}}
| ChemSpiderID = 4759
| InChI = 1/C10H19N5O/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15)
| InChIKey = ISEUFVQQFVOBCY-UHFFFAOYAG
| StdInChI_Ref = {{Stdinchicite|changed|chemspider}}
| StdInChI = 1S/C10H19N5O/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15)
| StdInChIKey_Ref = {{Stdinchicite|changed|chemspider}}
| StdInChIKey = ISEUFVQQFVOBCY-UHFFFAOYSA-N
  }}
|قسم2={{معلومات كيمياء - خواص
| Formula=C<sub>10</sub>H<sub>19</sub>N<sub>5</sub>O
| MolarMass=225.29 غ/مول
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
  }}
|قسم3={{معلومات كيمياء - مخاطر
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}
'''بروميتون''' هو [[مبيد أعشاب]] يستخدم [[أعشاب ضارة|للأعشاب الضارة]] `ذات [[ورق|الأوراق]] العريضة ال[[نبات حولي|حولية]] والمعمرة، والأجمات و[[نجيلية|النجيل]] بشكل رئيسي في [[نبات|النباتات]]  غير المحصولية.<ref>{{استشهاد ويب| مسار = https://fdasis.nlm.nih.gov/srs/unii/DY7SQ0399L | عنوان = معلومات عن بروميتون على موقع fdasis.nlm.nih.gov | ناشر = fdasis.nlm.nih.gov| مسار أرشيف = https://web.archive.org/web/20200613032544/https://fdasis.nlm.nih.gov/srs/unii/DY7SQ0399L | تاريخ أرشيف = 13 يونيو 2020 }}</ref><ref>{{استشهاد ويب| مسار = https://comptox.epa.gov/dashboard/DTXSID6022341 | عنوان = معلومات عن بروميتون على موقع comptox.epa.gov | ناشر = comptox.epa.gov| مسار الأرشيف = https://web.archive.org/web/20190510020410/https://comptox.epa.gov/dashboard/DTXSID6022341 | تاريخ الأرشيف = 10 مايو 2019 }}</ref><ref>{{استشهاد ويب| مسار = https://pubchem.ncbi.nlm.nih.gov/compound/4928 | عنوان = معلومات عن بروميتون على موقع pubchem.ncbi.nlm.nih.gov | ناشر = pubchem.ncbi.nlm.nih.gov| مسار الأرشيف = https://web.archive.org/web/20220509111932/https://pubchem.ncbi.nlm.nih.gov/compound/4928 | تاريخ الأرشيف = 9 مايو 2022 }}</ref>