عرض مصدر أرنولول

{{وصلات قليلة|تاريخ=مارس 2016}}
{{صندوق معلومات دواء
| IUPAC_name        = 3-amino-1-[4-(2-methoxyethyl)phenoxy]-3-methyl-butan-2-ol
| image             = arnolol.png
| InChI = 1/C14H23NO3/c1-14(2,15)13(16)10-18-12-6-4-11(5-7-12)8-9-17-3/h4-7,13,16H,8-10,15H2,1-3H3
| InChIKey = LAWLHMWODZUZJH-UHFFFAOYAV
| CAS_number        = 87129-71-3
| ATC_prefix        = 
| ATC_suffix        = 
| PubChem           = 65653
| DrugBank          = 
| ChemSpiderID      = 59090
| C = 14 | H = 23 | N = 1 | O = 3
| molecular_weight  = 253.34 g/mol
| smiles            = O(c1ccc(cc1)CCOC)CC(O)C(N)(C)C
| bioavailability   = 
| metabolism        = 
| elimination_half-life = 
| excretion         = 
| pregnancy_category= 
| legal_status      = 
| routes_of_administration = 
}}

'''الأرنولول''' {{إنج|Arnolol}} هو [[محصر بيتا]].<ref name="urlThe Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs">{{استشهاد ويب | مسار = https://apps.who.int/medicinedocs/en/d/Js4895e/6.html | عنوان = The Use of Common Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances: Alphabetical list of stems together with corresponding INNs| مسار أرشيف = https://web.archive.org/web/20180310185405/http://apps.who.int/medicinedocs/en/d/Js4895e/6.html | تاريخ أرشيف = 10 مارس 2018 | وصلة مكسورة = yes | تاريخ الوصول =  أكتوبر 2020  }}</ref>