عرض مصدر أربوتين

{{يتيمة|تاريخ=نوفمبر 2017}}
{{معلومات كيمياء
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 396293096
| صورة = Arbutin structure.svg
| الاسم النظامي = (''2R,3S,4S,5R,6S'')-2-Hydroxymethyl-6- (4-hydroxyphenoxy)oxane-3,4,5-triol
| أسماء أخرى = Arbutoside<br />Hydroquinone β-D-glucopyranoside
|قسم1={{معلومات كيمياء - معرفات
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 389765
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 232202
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C5INA23HXF
| InChIKey = BJRNKVDFDLYUGJ-RMPHRYRLBW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BJRNKVDFDLYUGJ-RMPHRYRLSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 497-76-7
| EINECS =
| PubChem = 346
| SMILES = c1cc(ccc1O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
| InChI = 1/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12-/m1/s1
| RTECS = CE8663000
| MeSHName =
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 18305
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
}}
|قسم2={{معلومات كيمياء - خواص
| C=12 | H=16 | O=7
| Appearance = مسحوق عديم اللاون إلى أبيض
| Density =
| MeltingPtC = 199.5
| MeltingPt_notes =
| BoilingPt = 561.6
| BoilingPt_notes =
| Solubility = 5.0 غم/100 مل
| SolubleOther = ذائب في [[كحول|الكحول]] <br /> قليل الذوبان في [[ثنائي إيثيل الإيثر|إيثيل الإيثر]] <br /> غير ذائب في [[بنزين (مركب كيميائي)|البنزين]] وال[[كلوروفورم]] و[[ثنائي كبريتيد الكربون]]
| pKa =
| pKb = 
| LogP = -1.35
| VaporPressure = تقريبا 0 (25 °س)
| MagSus = -158.0·10<sup>−6</sup> سم<sup>3</sup>/مول
}}
|قسم7={{معلومات كيمياء - مخاطر
| ExternalSDS = [http://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=PL&language=EN-generic&productNumber=10960&brand=FLUKA&PageToGoToURL=http%3A%2F%2Fwww.sigmaaldrich.com%2Fcatalog%2Fproduct%2Ffluka%2F10960%3Flang%3Dpl Sigma-Aldrich]
| EUClass =
| MainHazards =
| NFPA-H = 0
| NFPA-F = 0
| NFPA-R = 0
| NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPtC = 293.4
| AutoignitionPtC =
| ExploLimits =
| PEL = 
}}
}}
'''أربوتين''' هو [[غليكوسيد]]، وهو مستخلص [[هيدروكينون]] غليكوسيدي من نبات [[عنب الدب]]، كما يتوفر في ال[[قمح]] وفي قشرة [[كمثرى (جنس)|الإجاص]]. كما يوجد في ال[[برغنية سميكة الأوراق]]،<ref>{{استشهاد بدورية محكمة|مسار=http://notulaebotanicae.ro/nbha/article/viewFile/3108/2947 |عنوان=Natural Resources Containing Arbutin. Determination of Arbutin in the Leaves of Bergenia crassifolia (L.) Fritsch. acclimated in Romania |مؤلف1=Carmen Pop |مؤلف2=Laurian Vlase |مؤلف3=Mircea Tamas |صحيفة=Not. Bot. Hort. Agrobot. Cluj |المجلد=37 |العدد=1 |سنة=2009 |صفحات=129–132 |مسار أرشيف=https://web.archive.org/web/20110823104032/http://notulaebotanicae.ro/nbha/article/viewFile/3108/2947 |تاريخ أرشيف=2011-08-23 |url-status=dead}}</ref> كما يمكن إنتاجه [[في المختبر|مختبريا]] في  [[مستنبت]] [[شزندرة صينية|الشزندرة الصينية]].<ref>{{استشهاد بدورية محكمة | pmid = 15895970 | عنوان = [Arbutin, salicin: the possibilities of their biotechnological production] |عدة مؤلفين=Dusková J, Dusek J, Jahodár L, Poustka F | صحيفة = Ceska Slov Farm. | المجلد = 54 | العدد = 2 | سنة = 2005 | صفحات = 78–81}}</ref>

[[مثبط إنزيم|يثبط]] أربوتين ال[[تايروسيناز]] مما يؤدي إلى منع تكوين ال[[ميلانين]]، لذا يستعمل في [[تفتيح البشرة]] دون التعرض للشمس.